N-(2-Carboxy-3-phenylpropanoyl)-L-leucine structure
|
Common Name | N-(2-Carboxy-3-phenylpropanoyl)-L-leucine | ||
|---|---|---|---|---|
| CAS Number | 209127-97-9 | Molecular Weight | 307.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-Carboxy-3-phenylpropanoyl)-L-leucine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H21NO5 |
|---|---|
| Molecular Weight | 307.34200 |
| Exact Mass | 307.14200 |
| PSA | 107.19000 |
| LogP | 2.38570 |
| InChIKey | REOCNKZXONOGGX-ABLWVSNPSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)C(=O)O)C(=O)O |
|
~93%
N-(2-Carboxy-3-... CAS#:209127-97-9 |
| Literature: Fournie Zaluski; Chaillet; Soroca Lucas; Fournie-Zaluski; Marcais-Collado; Costentin; Roques Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 60 - 65 |
|
~%
N-(2-Carboxy-3-... CAS#:209127-97-9 |
| Literature: Fournie Zaluski; Chaillet; Soroca Lucas; Fournie-Zaluski; Marcais-Collado; Costentin; Roques Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 60 - 65 |
|
~%
N-(2-Carboxy-3-... CAS#:209127-97-9 |
| Literature: Fournie Zaluski; Chaillet; Soroca Lucas; Fournie-Zaluski; Marcais-Collado; Costentin; Roques Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 60 - 65 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (R)-N-(methoxymethyl)-1-phenyl-N-((trimethylsilyl)methyl)ethanamine |
| (R)-(+)-N-METHOXYMETHYL-N-(TRIMETHYLSILYL)METHYL-1-PHENYLETH |
| N-[(R)-1-phenylethyl]-N-(methoxymethyl)-N-(trimethylsilylmethyl)amine |
| (R)-N-(1-phenylethyl)-N-(methoxymethyl)-N-(trimethylsilylmethyl)amine |
| N-(trimethylsilylmethyl)-N-methoxymethyl-1-methylbenzylamine |
| N-<(RS)-2-carboxy-3-phenylpropanoyl>-L-leucine |
| (R)-N-METHOXYMETHYL-N-(1-PHENYLETHYL)-N-TRIMETHYLSILYLMETHYLAMINE |
| (R)-(+)-N-METHOXYMETHYL-N-(TRIMETHYLSILYL)METHYL-1-PHENYLETHYLAMINE: TECH. |
| (1R)-N-(methoxymethyl)-1-phenyl-N-[(trimethylsilyl)methyl]ethanamine |
| (R)-(+)-N-1-phenylethyl-N-(methoxymethyl)trimethylsilylmethylamine |