BDP FL-PEG5-propargyl structure
|
Common Name | BDP FL-PEG5-propargyl | ||
|---|---|---|---|---|
| CAS Number | 2093197-93-2 | Molecular Weight | 549.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38BF2N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP FL-PEG5-propargylBDP FL-PEG5-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | BDP FL-PEG5-propargyl |
|---|---|
| Synonym | More Synonyms |
| Description | BDP FL-PEG5-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C27H38BF2N3O6 |
|---|---|
| Molecular Weight | 549.41 |
| InChIKey | GPYLESDPNBDJRD-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCNC(=O)CCC1=[N+]2C(=Cc3c(C)cc(C)n3[B-]2(F)F)C=C1 |
| MFCD30723294 |