BDP FL-PEG5-acid structure
|
Common Name | BDP FL-PEG5-acid | ||
|---|---|---|---|---|
| CAS Number | 2093197-98-7 | Molecular Weight | 583.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H40BF2N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP FL-PEG5-acidBDP FL-PEG5-acid is a BDP FL acid linker containing a hydrophilic PEG spacer arm. BDP FL-PEG5-acid can be used in the synthesis of PROTACs. BDP FL is a green-fluorescent dye, and the hydrophilic PEG spacer arm increases water solubility and membrane permability. |
| Name | BDP FL-PEG5-acid |
|---|
| Description | BDP FL-PEG5-acid is a BDP FL acid linker containing a hydrophilic PEG spacer arm. BDP FL-PEG5-acid can be used in the synthesis of PROTACs. BDP FL is a green-fluorescent dye, and the hydrophilic PEG spacer arm increases water solubility and membrane permability. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| References |
| Molecular Formula | C27H40BF2N3O8 |
|---|---|
| Molecular Weight | 583.43 |
| InChIKey | VSTRTPYBEMVINA-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2c1C=C1C=CC(CCC(=O)NCCOCCOCCOCCOCCOCCC(=O)O)=[N+]1[B-]2(F)F |