M-tetramethylxylene isocyanate structure
|
Common Name | M-tetramethylxylene isocyanate | ||
|---|---|---|---|---|
| CAS Number | 2094-99-7 | Molecular Weight | 201.26400 | |
| Density | 1.018 g/mL at 25 °C(lit.) | Boiling Point | 268-271 °C(lit.) | |
| Molecular Formula | C13H15NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 1-(2-isocyanatopropan-2-yl)-3-prop-1-en-2-ylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.018 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 268-271 °C(lit.) |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.26400 |
| Flash Point | >230 °F |
| Exact Mass | 201.11500 |
| PSA | 29.43000 |
| LogP | 3.29060 |
| Vapour Pressure | 0.00723mmHg at 25°C |
| Index of Refraction | n20/D 1.53(lit.) |
| InChIKey | ZVEMLYIXBCTVOF-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cccc(C(C)(C)N=C=O)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317-H330-H334-H373-H410 |
| Precautionary Statements | P260-P280-P284-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338-P342 + P311-P403 + P233 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T+: Very toxic;N: Dangerous for the environment; |
| Risk Phrases | R26 |
| Safety Phrases | S7-S15-S28-S36/37/39-S38-S45-S60-S61 |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | DA3685000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2929109000 |
|
~%
M-tetramethylxy... CAS#:2094-99-7 |
| Literature: Journal of Organic Chemistry, , vol. 29, p. 143 - 145 |
| HS Code | 2929109000 |
|---|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Oligomers with pendant isocyanate groups as tissue adhesives. I. Synthesis and characterization.
J. Biomed. Mater. Res. 23(3) , 295-309, (1989) A series of methacrylate oligomers containing pendant isocyanate groups were synthesized by reacting 2-isocyanatoethyl methacrylate (IEM) and/or m-isopropenyl-alpha, alpha-dimethylbenzyl isocyanate (T... |
| 3-Isopropenylcumyl Isocyanate |
| Isocyanic Acid 3-Isopropenylcumyl Ester |
| Isocyanic Acid 3-Isopropenyl-α,α-dimethylbenzyl Ester |
| 1-methyl-1-[3-(1-methylethenyl)phenyl]ethyl isocyanate |
| 1-(1-isocyanato-1-methylethyl)-3-(1-methylethenyl)-benzene |
| EINECS 402-440-2 |
| MFCD00080490 |
| 3-Isopropenyl-α,α-dimethylbenzyl Isocyanate |