N-Boc-2-(4'-chlorophenyl)-DL-glycine structure
|
Common Name | N-Boc-2-(4'-chlorophenyl)-DL-glycine | ||
|---|---|---|---|---|
| CAS Number | 209525-73-5 | Molecular Weight | 285.723 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 438.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H16ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.2±27.3 °C | |
| Name | 2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.8±40.0 °C at 760 mmHg |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.723 |
| Flash Point | 219.2±27.3 °C |
| Exact Mass | 285.076782 |
| PSA | 75.63000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | ZZONJNNLTAGSHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Chlorophenyl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| Benzeneacetic acid, 4-chloro-α-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| [(tert-Butoxycarbonyl)amino](4-chlorophenyl)acetic acid |