N-Boc-2-(4-trifluoromethylphenyl)-DL-glycine structure
|
Common Name | N-Boc-2-(4-trifluoromethylphenyl)-DL-glycine | ||
|---|---|---|---|---|
| CAS Number | 847147-40-4 | Molecular Weight | 319.27600 | |
| Density | 1.297g/cm3 | Boiling Point | 416.4ºC at 760 mmHg | |
| Molecular Formula | C14H16F3NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 205.6ºC | |
| Name | N-Boc-2-(4-trifluoromethylphenyl)-DL-glycine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 416.4ºC at 760 mmHg |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.27600 |
| Flash Point | 205.6ºC |
| Exact Mass | 319.10300 |
| PSA | 75.63000 |
| LogP | 3.74670 |
| Index of Refraction | 1.487 |
| InChIKey | RAIYJIQGEQQZLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethyl)phenyl]acetic acid |