1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene structure
|
Common Name | 1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 209625-37-6 | Molecular Weight | 422.195 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 439.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H26Br2O2 | Melting Point | 82-86ºC | |
| MSDS | Chinese USA | Flash Point | 182.3±25.8 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2,5-Bis(bromomethyl)-4-(2-ethylhexyloxy)anisole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.3±40.0 °C at 760 mmHg |
| Melting Point | 82-86ºC |
| Molecular Formula | C17H26Br2O2 |
| Molecular Weight | 422.195 |
| Flash Point | 182.3±25.8 °C |
| Exact Mass | 420.029938 |
| PSA | 18.46000 |
| LogP | 7.04 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | WFGYUUWEXFKLCS-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COc1cc(CBr)c(OC)cc1CBr |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | 26-27-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| HS Code | 2909309090 |
|
~%
1,4-Bis(bromome... CAS#:209625-37-6 |
| Literature: Chemistry - A European Journal, , vol. 6, # 8 p. 1318 - 1321 |
|
~%
1,4-Bis(bromome... CAS#:209625-37-6 |
| Literature: Journal of the American Chemical Society, , vol. 123, # 46 p. 11388 - 11397 |
|
~%
1,4-Bis(bromome... CAS#:209625-37-6 |
| Literature: Journal of the American Chemical Society, , vol. 123, # 46 p. 11388 - 11397 |
|
~%
1,4-Bis(bromome... CAS#:209625-37-6 |
| Literature: Monatshefte fur Chemie, , vol. 145, # 1 p. 85 - 90 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Chem. Commun. (Camb.) , 2347, (1999)
|
| 1,4-bis(bromomethyl)-2-(2-ethylhexoxy)-5-methoxybenzene |
| 1,4-Bis(bromomethyl)-2-((2-ethylhexyl)oxy)-5-methoxybenzene |
| 1,4-Bis(bromomethyl)-2-[(2-ethylhexyl)oxy]-5-methoxybenzene |
| Benzene, 1,4-bis(bromomethyl)-2-[(2-ethylhexyl)oxy]-5-methoxy- |
| MFCD03093944 |
| 2,5-bis(bromomethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene |