11-Oxomogroside IV structure
|
Common Name | 11-Oxomogroside IV | ||
|---|---|---|---|---|
| CAS Number | 2096516-32-2 | Molecular Weight | 1123.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C54H90O24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 11-Oxomogroside IV11-Oxomogroside IV is a natural compound that could be found in the fruits of Siraitia grosvenori[1]. |
| Name | 11-Oxomogroside IV |
|---|
| Description | 11-Oxomogroside IV is a natural compound that could be found in the fruits of Siraitia grosvenori[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C54H90O24 |
|---|---|
| Molecular Weight | 1123.28 |
| InChIKey | YWAKRLANXLYUMX-UHFFFAOYSA-N |
| SMILES | CC(CCC(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(C)(C)O)C1CCC2(C)C3CC=C4C(CCC(OC5OC(COC6OC(CO)C(O)C(O)C6O)C(O)C(O)C5O)C4(C)C)C3(C)C(=O)CC12C |