Ethanone, 1,1- (1,4,-dihydro-2,6-dimethyl-4-phenyl-3, 5-pyridinediyl)bis- structure
|
Common Name | Ethanone, 1,1- (1,4,-dihydro-2,6-dimethyl-4-phenyl-3, 5-pyridinediyl)bis- | ||
|---|---|---|---|---|
| CAS Number | 20970-67-6 | Molecular Weight | 269.33800 | |
| Density | 1.087g/cm3 | Boiling Point | 440ºC at 760 mmHg | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.9ºC | |
| Name | 1-(5-acetyl-2,6-dimethyl-4-phenyl-1,4-dihydropyridin-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 440ºC at 760 mmHg |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.33800 |
| Flash Point | 159.9ºC |
| Exact Mass | 269.14200 |
| PSA | 46.17000 |
| LogP | 3.42820 |
| Vapour Pressure | 6.09E-08mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | GAJJRTVBAXALLD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C)NC(C)=C(C(C)=O)C1c1ccccc1 |
| HS Code | 2933399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-diacetyl-4-phenyl-2,6-dimethyl-1,4-dihydropyridine |
| 4-Phenyl-2,6-dimethyl-3,5-diacetyl-1,4-dihydropyridine |
| 3,5-diacetyl-2,6-dimethyl-4-phenyl-1,4-dihydro-pyridine |