ethyl (3-chlorophenyl)carbamothioylsulfanylformate structure
|
Common Name | ethyl (3-chlorophenyl)carbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 20976-09-4 | Molecular Weight | 275.77500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (3-chlorophenyl)carbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10ClNO2S2 |
|---|---|
| Molecular Weight | 275.77500 |
| Exact Mass | 274.98400 |
| PSA | 102.76000 |
| LogP | 4.14700 |
| Vapour Pressure | 1.51E-05mmHg at 25°C |
| InChIKey | FJNGPEZYEHLNKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)Nc1cccc(Cl)c1 |
| Thiocarbonic acid anhydrosulfide with m-chlorodithiocarbanilic acid ethyl ester |
| Carbonic acid,thio-,anhydrosulfide with m-chlorodithiocarbanilic acid,ethyl ester |