E3 ligase Ligand-Linker Conjugates 6 structure
|
Common Name | E3 ligase Ligand-Linker Conjugates 6 | ||
|---|---|---|---|---|
| CAS Number | 2097973-72-1 | Molecular Weight | 612.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H42ClN5O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of E3 ligase Ligand-Linker Conjugates 6E3 ligase Ligand-Linker Conjugates 6 is a synthesized compound that incorporates an E3 ligase ligand and a linker used in PROTAC technology. |
| Name | E3 ligase Ligand-Linker Conjugates 6 |
|---|
| Description | E3 ligase Ligand-Linker Conjugates 6 is a synthesized compound that incorporates an E3 ligase ligand and a linker used in PROTAC technology. |
|---|---|
| Related Catalog | |
| Target |
E3 Ligase Ligand-Linker Conjugate[1] |
| Molecular Formula | C28H42ClN5O6S |
|---|---|
| Molecular Weight | 612.18 |
| InChIKey | SYAOHFUUVWFWJH-ZBXLSASTSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)COCCOCCN)C(C)(C)C)cc1.Cl |
| Storage condition | 2-8℃ |