4-(3-methoxyphenyl)benzaldehyde structure
|
Common Name | 4-(3-methoxyphenyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 209863-09-2 | Molecular Weight | 212.24400 | |
| Density | 1.114 g/cm3 | Boiling Point | 356.7ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.7ºC | |
| Name | 3'-Methoxy-biphenyl-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114 g/cm3 |
|---|---|
| Boiling Point | 356.7ºC at 760 mmHg |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 163.7ºC |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 3.17470 |
| InChIKey | LHVLDSOAJZLBMM-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2ccc(C=O)cc2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3-METHOXYPHENYL)BENZALDEHYDE |
| MFCD03424619 |
| 3'-Methoxy-[1,1'-biphenyl]-4-carbaldehyde |