4-P-TOLYLTHIAZOL-2-OL structure
|
Common Name | 4-P-TOLYLTHIAZOL-2-OL | ||
|---|---|---|---|---|
| CAS Number | 2103-90-4 | Molecular Weight | 191.25000 | |
| Density | 1.254 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-Methylphenyl)-1,3-thiazol-2(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254 g/cm3 |
|---|---|
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25000 |
| Exact Mass | 191.04000 |
| PSA | 61.36000 |
| LogP | 2.82410 |
| InChIKey | FKFCXWOMNWZZQG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2csc(=O)[nH]2)cc1 |
| HS Code | 2934100090 |
|---|
|
~%
4-P-TOLYLTHIAZO... CAS#:2103-90-4 |
| Literature: Pihlaja, Kalevi; Ovcharenko, Vladimir; Kolehmainen, Erkki; Laihia, Katri; Fabian, Walter M.F.; Dehne, Heinz; Perjessy, Alexander; Kleist, Marion; Teller, Joachim; Sustekova, Zora Journal of the Chemical Society Perkin Transactions 2, 2002 , vol. 2, p. 329 - 336 |
|
~%
4-P-TOLYLTHIAZO... CAS#:2103-90-4 |
| Literature: Prakash; Saini Synthetic Communications, 1993 , vol. 23, # 10 p. 1455 - 1462 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-p-tolyl-3,4,5,6,7,8-hexahydro-1H-quinazoline-2-thione |
| 4-p-Tolyl-3H-thiazol-2-on |
| 2(1H)-Quinazolinethione,3,4,5,6,7,8-hexahydro-4-(4-methylphenyl) |
| 4-(4-methylphenyl)-2-oxo-thiazole |
| 4-p-tolyl-3H-thiazol-2-one |
| 4-(p-methylphenyl)-1,2,3,4,5,6,7,8-octahydroquinazoline-2-thione |