2(3H)-Thiazolone,4-(4-chlorophenyl)- structure
|
Common Name | 2(3H)-Thiazolone,4-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2103-98-2 | Molecular Weight | 211.66800 | |
| Density | 1.428g/cm3 | Boiling Point | 410.2ºC at 760mmHg | |
| Molecular Formula | C9H6ClNOS | Melting Point | 222-226ºC | |
| MSDS | Chinese USA | Flash Point | 201.9ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 4-(4-chlorophenyl)-3H-1,3-thiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760mmHg |
| Melting Point | 222-226ºC |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.66800 |
| Flash Point | 201.9ºC |
| Exact Mass | 210.98600 |
| PSA | 61.10000 |
| LogP | 2.75680 |
| Vapour Pressure | 2.58E-07mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | XODFWCAVOQHJFC-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)cs1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2934100090 |
|
~91%
2(3H)-Thiazolon... CAS#:2103-98-2 |
| Literature: Takeda Chemical Industries, Ltd.; Kusaka, Masami Patent: EP1348706 A1, 2003 ; Location in patent: Page/Page column 40-41 ; |
|
~66%
2(3H)-Thiazolon... CAS#:2103-98-2 |
| Literature: Sanemitsu; Kawamura; Tanabe Journal of Organic Chemistry, 1992 , vol. 57, # 3 p. 1053 - 1056 |
|
~%
2(3H)-Thiazolon... CAS#:2103-98-2 |
| Literature: Journal of the American Chemical Society, , vol. 80, p. 5198 |
|
~%
2(3H)-Thiazolon... CAS#:2103-98-2 |
| Literature: Synthetic Communications, , vol. 23, # 10 p. 1455 - 1462 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(4-chlorophenyl)-2-oxo-1,3-thiazole |
| 4-p-Chlorphenyl-4-thiazolin-2-on |
| (4-chlorophenyl)-2(3H)-thiazolone |
| 4-(4-Chlor-phenyl)-3H-thiazol-2-on |
| 4-(4-chloro-phenyl)-3H-thiazol-2-one |
| 4-(4-CHLOROPHENYL)-2-HYDROXYTHIAZOLE |
| 2-thiazolol,4-(4-chlorophenyl) |
| 4-(4-chlorophenyl)-2-oxo-thiazole |