Bromofos structure
|
Common Name | Bromofos | ||
|---|---|---|---|---|
| CAS Number | 2104-96-3 | Molecular Weight | 365.996 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 360.8±52.0 °C at 760 mmHg | |
| Molecular Formula | C8H8BrCl2O3PS | Melting Point | 53-56 °C | |
| MSDS | Chinese USA | Flash Point | 172.0±30.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of BromofosBromofos is a pesticide. |
| Name | bromophos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.8±52.0 °C at 760 mmHg |
| Melting Point | 53-56 °C |
| Molecular Formula | C8H8BrCl2O3PS |
| Molecular Weight | 365.996 |
| Flash Point | 172.0±30.7 °C |
| Exact Mass | 363.849213 |
| PSA | 69.59000 |
| LogP | 5.07 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | NYQDCVLCJXRDSK-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1cc(Cl)c(Br)cc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H410 |
| Precautionary Statements | P273-P301 + P312 + P330-P391-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22;R50/53 |
| Safety Phrases | S2-S36-S60-S61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | TE7175000 |
| HS Code | 2920190090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Destruction of halogen-containing pesticides by means of detonation combustion.
Environ. Sci. Pollut. Res. Int. 20(2) , 855-61, (2013) Pesticides that contain a halogen functional group have been destructed by means of detonative combustion. The following compounds were examined: (1) atrazine-2-chloro-4-ethylamino-6-isopropylamino-1,... |
|
|
[The effect of noxious chemicals on the sperm quality of boars used for insemination. 1. The fly control agent "omexan"].
Arch. Exp. Veterinarmed. 42(3) , 435-43, (1988)
|
|
|
Endocrine changes in patients with acute organophosphate poisoning.
Hum. Exp. Toxicol. 18(10) , 598-601, (1999) In critical illness, several drugs and various stressful conditions modify the functions of neurotransmitters which consequently affect the secretion of pituitary hormones. Although the role of neurot... |
| Bromovur |
| Omexan |
| Mexion |
| O-(4-Bromo-2,5-dichlorophenyl) O,O-dimethyl phosphorothioate |
| Nexion |
| Bromophos-methyl |
| O-(4-Brom-2,5-dichlorphenyl)-O,O-dimethylthiophosphat |
| O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
| Bromophos |
| Bromophos methyl |
| Drillzid |
| (4-bromo-2,5-dichlorophenoxy)-dimethoxy-sulfanylidene-λ<sup>5</sup>-phosphane |
| Bromofos |
| O-(4-Bromo-2,5-dichlorophenyl)-O,O-dimethylphosphorothioate |
| Phosphorothioic acid, O-(4-bromo-2,5-dichlorophenyl) O,O-dimethyl ester |
| Brofene |
| MFCD00055261 |
| Nexagan |
| Brophene |
| EINECS 218-277-3 |