Hydroxyebastine structure
|
Common Name | Hydroxyebastine | ||
|---|---|---|---|---|
| CAS Number | 210686-41-2 | Molecular Weight | 485.65700 | |
| Density | 1.141g/cm3 | Boiling Point | 632.848ºC at 760 mmHg | |
| Molecular Formula | C32H39NO3 | Melting Point | 53-55ºC | |
| MSDS | N/A | Flash Point | 336.535ºC | |
Use of HydroxyebastineHydroxyebastine is an ebastine metabolite. |
| Name | 4-(4-benzhydryloxypiperidin-1-yl)-1-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 632.848ºC at 760 mmHg |
| Melting Point | 53-55ºC |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.65700 |
| Flash Point | 336.535ºC |
| Exact Mass | 485.29300 |
| PSA | 49.77000 |
| LogP | 6.12790 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | UDZUMQUGNZBRMN-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)c1ccc(C(=O)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)cc1 |
|
~61%
Hydroxyebastine CAS#:210686-41-2 |
| Literature: El Ouarradi, Amane; Salard-Arnaud, Isabelle; Buisson, Didier Tetrahedron, 2008 , vol. 64, # 51 p. 11738 - 11744 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(4-(1-Oxo-4-(4-(hydroxydiphenylmethyl)-1-piperidinyl)-butyl)-phenyl)-2-methyl-propanol |
| 4-(4-(benzhydryloxy)piperidin-1-yl)-1-(4-(1-hydroxy-2-methylpropan-2-yl)phenyl)butan-1-one |
| Hydroxyebastine |
| 4-[4-(Diphenylmethoxy)-1-piperidinyl]-1-[4-(2-hydroxy-1,1-dimethylethyl)phenyl]-1-butanone |