PTH-α-aminoisobutyric acid structure
|
Common Name | PTH-α-aminoisobutyric acid | ||
|---|---|---|---|---|
| CAS Number | 21083-30-7 | Molecular Weight | 220.29100 | |
| Density | 1.29g/cm3 | Boiling Point | 299.9ºC at 760 mmHg | |
| Molecular Formula | C11H12N2OS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 135.2ºC | |
| Name | PTH-α-aminoisobutyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 299.9ºC at 760 mmHg |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.29100 |
| Flash Point | 135.2ºC |
| Exact Mass | 220.06700 |
| PSA | 64.43000 |
| LogP | 2.08010 |
| Vapour Pressure | 0.00116mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | SOWKARYGXPPVML-UHFFFAOYSA-N |
| SMILES | CC1(C)NC(=S)N(c2ccccc2)C1=O |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5-dimethyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |