1-(Pyridin-4-yl)piperidine-4-carboxylic acid hydrochloride structure
|
Common Name | 1-(Pyridin-4-yl)piperidine-4-carboxylic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 210962-09-7 | Molecular Weight | 242.702 | |
| Density | N/A | Boiling Point | 431.5ºC at 760 mmHg | |
| Molecular Formula | C11H15ClN2O2 | Melting Point | 223-226ºC(lit.) | |
| MSDS | USA | Flash Point | 214.7ºC | |
| Name | 1-pyridin-4-ylpiperidine-4-carboxylic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 431.5ºC at 760 mmHg |
|---|---|
| Melting Point | 223-226ºC(lit.) |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.702 |
| Flash Point | 214.7ºC |
| Exact Mass | 242.082199 |
| PSA | 53.43000 |
| LogP | 2.24960 |
| Vapour Pressure | 3.28E-08mmHg at 25°C |
| InChIKey | AFFOXJSAQYSQIM-UHFFFAOYSA-N |
| SMILES | Cl.O=C(O)C1CCN(c2ccncc2)CC1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Piperidinecarboxylic acid, 1-(4-pyridinyl)-, hydrochloride (1:1) |
| MFCD04039919 |
| 1-(pyridin-4-yl)piperidine-4-carboxylic acid hydrochloride |
| 1-(4-Pyridinyl)-4-piperidinecaboxylic acid monohydrochloride |
| 1-(4-Pyridinyl)-4-piperidinecarboxylic acid hydrochloride (1:1) |
| 1-(4-pyridyl)piperidine-4-carboxylic acid,chloride |