15(R)-15-methyl Prostaglandin D2 structure
|
Common Name | 15(R)-15-methyl Prostaglandin D2 | ||
|---|---|---|---|---|
| CAS Number | 210978-26-0 | Molecular Weight | 366.492 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 554.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.0±26.6 °C | |
Use of 15(R)-15-methyl Prostaglandin D215(R)-15-methyl Prostaglandin D2 (15(R)-15-methyl PGD2) is a metabolically stable synthetic analog of PGD2. |
| Name | 7-[(2R)-5-hydroxy-2-[(3R)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 554.2±50.0 °C at 760 mmHg |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.492 |
| Flash Point | 303.0±26.6 °C |
| Exact Mass | 366.240631 |
| PSA | 94.83000 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | CTXLUMAOXBULOZ-BKVRKCTKSA-N |
| SMILES | CCCCCC(C)(O)C=CC1C(=O)CC(O)C1CC=CCCCC(=O)O |
| (5Z,9α,13E,15R)-9,15-Dihydroxy-15-methyl-11-oxoprosta-5,13-dien-1-oic acid |
| Prosta-5,13-dien-1-oic acid, 9,15-dihydroxy-15-methyl-11-oxo-, (5Z,9α,13E,15R)- |