O-[(Benzyloxy)carbonyl]-L-tyrosine structure
|
Common Name | O-[(Benzyloxy)carbonyl]-L-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 21106-04-7 | Molecular Weight | 315.321 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 510.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H17NO5 | Melting Point | 88 to 97ºC | |
| MSDS | N/A | Flash Point | 262.3±30.1 °C | |
| Name | O-Cbz-L-Tyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 510.2±50.0 °C at 760 mmHg |
| Melting Point | 88 to 97ºC |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.321 |
| Flash Point | 262.3±30.1 °C |
| Exact Mass | 315.110687 |
| PSA | 98.85000 |
| LogP | 2.16 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | UJTCGTXQJMMYLQ-HNNXBMFYSA-N |
| SMILES | NC(Cc1ccc(OC(=O)OCc2ccccc2)cc1)C(=O)O |
| Storage condition | Store at 0-5°C |
| HS Code | 2922509090 |
|---|
|
~%
O-[(Benzyloxy)c... CAS#:21106-04-7 |
| Literature: Journal of the Chemical Society, , p. 232,233 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O-Z-L-TYROSINE |
| O-carbobenzyloxy-L-tyrosine |
| O-cbz-L-tyrosine crystalline |
| O-[(Benzyloxy)carbonyl]-L-tyrosine |
| N-BENZYLOXYCARBONYL-L-TYROSINE HYDRATE |
| L-Tyrosine, O-[(phenylmethoxy)carbonyl]- |
| Cbz-Tyr-OH |
| O-Benzyloxycarbonyl-L-tyrosine |
| O-Benzyloxycarbonyl-L-tyrosin |
| O-carboxybenzyloxy-L-tyrosine |