2,3-Dichloro-6-nitrobenzonitrile structure
|
Common Name | 2,3-Dichloro-6-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 2112-22-3 | Molecular Weight | 217.009 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 343.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H2Cl2N2O2 | Melting Point | 93-96 °C(lit.) | |
| MSDS | USA | Flash Point | 161.6±27.9 °C | |
| Name | 2,3-Dichloro-6-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.6±42.0 °C at 760 mmHg |
| Melting Point | 93-96 °C(lit.) |
| Molecular Formula | C7H2Cl2N2O2 |
| Molecular Weight | 217.009 |
| Flash Point | 161.6±27.9 °C |
| Exact Mass | 215.949326 |
| PSA | 69.61000 |
| LogP | 2.62 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | RDFDRMZYAXQLRT-UHFFFAOYSA-N |
| SMILES | N#Cc1c([N+](=O)[O-])ccc(Cl)c1Cl |
| Storage condition | Refrigerator |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2926909090 |
|
~93%
2,3-Dichloro-6-... CAS#:2112-22-3 |
| Literature: AOP ORPHAN PHARMACEUTICALS AG Patent: WO2005/80398 A1, 2005 ; Location in patent: Page/Page column 4-5 ; |
|
~%
2,3-Dichloro-6-... CAS#:2112-22-3 |
| Literature: Journal fur Praktische Chemie - Chemiker - Zeitung, , vol. 338, # 7 p. 679 - 680 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
A Simple Synthesis of 2, 3-Dichloro-6-nitrobenzonitrile. Trinka P, et al.
J. Prakt. Chem. 338(1) , 679-680, (1996)
|
|
|
A convenient synthesis of ethyl (2-amino-5, 6-dichlorobenzyl) glycinate. Trinka P, et al.
J. Prakt. Chem. 338(1) , 675-678, (1996)
|
| 2-Cyano-3,4-dichloronitrobenzene |
| 5,6-Dichlor-2-nitrobenzol |
| 5,6-dichloro-2-nitrobenzonitrile |
| 2,3-Dichloro-6-nitrobenzonitrile |
| MFCD00728596 |
| 2,3-dichlro-6-nitrobenzonitrile |
| 2,3-dichloro-6-nitro-benzonitrile |
| 2-Nitro-5,6-dichlorbenzonitril |
| 2,3,5-TRIMETHYL-6-SECBUTYL PYRAZINE |
| 2,3-dichloro-6-nitrobenzenecarbonitrile |