4-(4-IODO-PHENOXY)-BENZOIC ACID structure
|
Common Name | 4-(4-IODO-PHENOXY)-BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 21120-69-4 | Molecular Weight | 340.11300 | |
| Density | 1.747g/cm3 | Boiling Point | 422.2ºC at 760 mmHg | |
| Molecular Formula | C13H9IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | 4-(4-Iodophenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.747g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760 mmHg |
| Molecular Formula | C13H9IO3 |
| Molecular Weight | 340.11300 |
| Flash Point | 209.1ºC |
| Exact Mass | 339.96000 |
| PSA | 46.53000 |
| LogP | 3.78170 |
| Vapour Pressure | 6.98E-08mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | MRSFBOVGCCIXLS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Oc2ccc(I)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
4-(4-IODO-PHENO... CAS#:21120-69-4 |
| Literature: DECODE CHEMISTRY, INC. Patent: US2007/66820 A1, 2007 ; Location in patent: Page/Page column 82 ; US 20070066820 A1 |
|
~%
4-(4-IODO-PHENO... CAS#:21120-69-4 |
| Literature: Slotta; Soremba Chemische Berichte, 1935 , vol. 68, p. 2059,2063 |
|
~%
4-(4-IODO-PHENO... CAS#:21120-69-4 |
| Literature: Slotta; Soremba Chemische Berichte, 1935 , vol. 68, p. 2059,2063 |
|
~%
4-(4-IODO-PHENO... CAS#:21120-69-4 |
| Literature: Slotta; Soremba Chemische Berichte, 1935 , vol. 68, p. 2059,2063 |
|
~%
4-(4-IODO-PHENO... CAS#:21120-69-4 |
| Literature: Slotta; Soremba Chemische Berichte, 1935 , vol. 68, p. 2059,2063 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4-(4-iodophenoxy) |
| 4-(4-iodo-phenoxy)-benzoic acid |
| 4-(4-Jod-phenoxy)-benzoesaeure |
| 4'-Carboxy-4-jod-diphenyl-aether |