4-(4-AMINO-PHENOXY)-BENZOIC ACID structure
|
Common Name | 4-(4-AMINO-PHENOXY)-BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 28999-69-1 | Molecular Weight | 229.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-Aminophenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO3 |
|---|---|
| Molecular Weight | 229.23100 |
| Exact Mass | 229.07400 |
| PSA | 72.55000 |
| LogP | 3.34050 |
| InChIKey | DVFCGSZRLJQHJA-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2922509090 |
|---|
|
~%
4-(4-AMINO-PHEN... CAS#:28999-69-1 |
| Literature: ARETE THERAPEUTICS, INC. Patent: WO2008/116145 A2, 2008 ; Location in patent: Page/Page column 106 ; |
|
~%
4-(4-AMINO-PHEN... CAS#:28999-69-1 |
| Literature: Mironov,G.S. et al. Zhurnal Organicheskoi Khimii, 1973 , vol. 9, # 1 p. 128 - 132,127 - 130 |
|
~%
4-(4-AMINO-PHEN... CAS#:28999-69-1 |
| Literature: Haeussermann; Bauer Chemische Berichte, 1896 , vol. 29, p. 2084 Chemische Berichte, 1897 , vol. 30, p. 738 Anm. 2 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(4-Amino-phenoxy)-benzoesaeure |
| 4'-Amino-diphenylaether-carbonsaeure-(4) |
| 4-(p-Aminophenoxy)-benzoesaeure |
| p-(p'-Aminophenoxy)-benzoesaeure |
| 4-(4-aminophenoxy) benzoic acid |