3-acetamidobiphenyl structure
|
Common Name | 3-acetamidobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 2113-54-4 | Molecular Weight | 211.25900 | |
| Density | 1.124g/cm3 | Boiling Point | 428.1ºC at 760mmHg | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.6ºC | |
| Name | N-(3-phenylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 428.1ºC at 760mmHg |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.25900 |
| Flash Point | 256.6ºC |
| Exact Mass | 211.10000 |
| PSA | 32.59000 |
| LogP | 3.96150 |
| Vapour Pressure | 1.56E-07mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | IRMSAKOLFSBQJH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(-c2ccccc2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-Phenylacetanilide |
| ACETANILIDE,3'-PHENYL |
| 3-Acetylaminobiphenyl |
| N-Acetoxy-3-aminobiphenyl |
| 3-Acetamidobiphenyl |
| N-Biphenyl-3-yl-acetamid |
| N-acetyl-3-phenylaniline |
| 3-Acetamino-diphenyl |