Diphenyliodonium trifluoromethanesulfonate structure
|
Common Name | Diphenyliodonium trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 66003-76-7 | Molecular Weight | 430.181 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10F3IO3S | Melting Point | 46-49 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Diphenyliodonium trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 46-49 °C(lit.) |
|---|---|
| Molecular Formula | C13H10F3IO3S |
| Molecular Weight | 430.181 |
| Exact Mass | 429.934723 |
| PSA | 65.58000 |
| LogP | 0.94720 |
| InChIKey | SBQIJPBUMNWUKN-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| Water Solubility | PGMEA: ~1% |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904909090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| diphenyliodanium,trifluoromethanesulfonate |
| Diphenyliodonium trifluoromethanesulfonate |
| MFCD00191356 |