Z-Lys(Z)-Osu structure
|
Common Name | Z-Lys(Z)-Osu | ||
|---|---|---|---|---|
| CAS Number | 21160-83-8 | Molecular Weight | 511.524 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H29N3O8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Z-Lys(Z)-OsuZ-Lys(Z)-OSu is a lysine derivative[1]. |
| Name | z-lys(z)-osu |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Lys(Z)-OSu is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C26H29N3O8 |
| Molecular Weight | 511.524 |
| Exact Mass | 511.195465 |
| PSA | 128.03000 |
| LogP | 2.23 |
| Index of Refraction | 1.600 |
| InChIKey | LHOAUCZIIQFZMI-NRFANRHFSA-N |
| SMILES | O=C(NCCCCC(NC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O)OCc1ccccc1 |
| Storage condition | -20C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2925190090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Z-LYSINE(Z)-OSU |
| Z-LYL(Z)-OSU |
| Z-LYS-OSU |
| Bis-N,N'-(Cbz)-L-lysine N-N-hydroxysuccinimide |
| Z-L-LYSINE N-HYDROXYSUCCINIMIDE ESTER |
| Lysine, N,N-bis[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| 2,5-Dioxo-1-pyrrolidinyl N,N-bis[(benzyloxy)carbonyl]lysinate |