Z-Lys(Z)-ONp structure
|
Common Name | Z-Lys(Z)-ONp | ||
|---|---|---|---|---|
| CAS Number | 21160-82-7 | Molecular Weight | 535.545 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 736.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C28H29N3O8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 399.0±32.9 °C | |
| Name | Z-Lys(Z)-ONp |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 736.2±60.0 °C at 760 mmHg |
| Molecular Formula | C28H29N3O8 |
| Molecular Weight | 535.545 |
| Flash Point | 399.0±32.9 °C |
| Exact Mass | 535.195435 |
| PSA | 148.78000 |
| LogP | 5.53 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | DQKARZJTYUBTMX-VWLOTQADSA-N |
| SMILES | O=C(NCCCCC(NC(=O)OCc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Nitrophenyl N2,N6-bis((phenylmethoxy)carbonyl)-L-lysinate |
| N2,N6-Bis[(benzyloxy)carbonyl]-L-lysine 4-nitrophenyl ester |
| Z-LYSINE(Z)-ONP |
| Lysine, N,N-bis[(phenylmethoxy)carbonyl]-, 4-nitrophenyl ester |
| N-a,N-e-di-Z-L-lysine4-nitrophenylester |
| 4-Nitrophenyl N,N-bis[(benzyloxy)carbonyl]-L-lysinate |
| 4-Nitrophenyl N,N-bis[(benzyloxy)carbonyl]lysinate |
| N2,N6-Bis[(Phenylmethoxy)Carbonyl]-L-Lysine 4-Nitrophenyl Ester |
| L-lysine, N,N-bis[(phenylmethoxy)carbonyl]-, 4-nitrophenyl ester |
| 4-nitrophenyl N2,N6-bis[(phenylmethoxy)carbonyl]-L-lysinate |