4-Chloro-7-(trifluoromethyl)-3-quinolinecarboxylic acid ethyl ester structure
|
Common Name | 4-Chloro-7-(trifluoromethyl)-3-quinolinecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21168-42-3 | Molecular Weight | 303.66400 | |
| Density | 1.402g/cm3 | Boiling Point | 338.688ºC at 760 mmHg | |
| Molecular Formula | C13H9ClF3NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 158.633ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 4-chloro-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 338.688ºC at 760 mmHg |
| Molecular Formula | C13H9ClF3NO2 |
| Molecular Weight | 303.66400 |
| Flash Point | 158.633ºC |
| Exact Mass | 303.02700 |
| PSA | 39.19000 |
| LogP | 4.08370 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | SKBIFKCXMGRLLK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2cc(C(F)(F)F)ccc2c1Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-7-trifluoromethylquinoline-3-carboxylic acid ethyl ester |
| ethyl 4-chloro-7-trifluoromethyl-3-quinolinecarboxylate |
| ethyl 4-chloro 7-trifluoromethyl quinoline 3-carboxylate |
| 4-chloro-7-trifluoro-quinoline-3-carboxylic acid ethyl ester |