Silane, [1, 4-phenylenebis (oxy)]bis[trimethyl- structure
|
Common Name | Silane, [1, 4-phenylenebis (oxy)]bis[trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 2117-24-0 | Molecular Weight | 254.47300 | |
| Density | 1.139g/cm3 | Boiling Point | 378.8ºC at 760 mmHg | |
| Molecular Formula | C12H22O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | trimethyl-(4-trimethylsilyloxyphenoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 378.8ºC at 760 mmHg |
| Molecular Formula | C12H22O2Si2 |
| Molecular Weight | 254.47300 |
| Flash Point | 182.9ºC |
| Exact Mass | 254.11600 |
| PSA | 18.46000 |
| LogP | 4.11400 |
| Vapour Pressure | 2.05E-06mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | DVLYYIZODAWMML-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1ccc(O[Si](C)(C)C)cc1 |
| Storage condition | 2~8℃ |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,4-Bis<trimethylsiloxy>benzene |
| 1,4-bis-trimethylsilanyloxy-benzene |