1,4-Bis(3,7-dimethyloctyl)benzene structure
|
Common Name | 1,4-Bis(3,7-dimethyloctyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 211809-80-2 | Molecular Weight | 358.643 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 436.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C26H46 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 219.0±8.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,4-Bis(3,7-dimethyloctyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.0±15.0 °C at 760 mmHg |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.643 |
| Flash Point | 219.0±8.5 °C |
| Exact Mass | 358.359955 |
| LogP | 11.97 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | XTDSXTPHPOPBPO-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCc1ccc(CCC(C)CCCC(C)C)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| 1,4-Bis(3,7-dimethyloctyl)benzene |
| MFCD08276755 |