trimethyl-[(2-methyl-3H-inden-1-yl)oxy]silane structure
|
Common Name | trimethyl-[(2-methyl-3H-inden-1-yl)oxy]silane | ||
|---|---|---|---|---|
| CAS Number | 211870-30-3 | Molecular Weight | 218.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[(2-methyl-3H-inden-1-yl)oxy]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18OSi |
|---|---|
| Molecular Weight | 218.36700 |
| Exact Mass | 218.11300 |
| PSA | 9.23000 |
| LogP | 3.82520 |
| InChIKey | QSPQGNGFVMFCBF-UHFFFAOYSA-N |
| SMILES | CC1=C(O[Si](C)(C)C)c2ccccc2C1 |
|
~95%
trimethyl-[(2-m... CAS#:211870-30-3 |
| Literature: Cheon, Cheol Hong; Kanno, Osamu; Toste, F. Dean Journal of the American Chemical Society, 2011 , vol. 133, # 34 p. 13248 - 13251 |
|
~%
trimethyl-[(2-m... CAS#:211870-30-3 |
| Literature: Eames, Jason; Weerasooriya, Neluka; Coumbarides, Gregory S. European Journal of Organic Chemistry, 2002 , # 1 p. 181 - 187 |
| 1-trimethylsilyloxy-2-methyl-3H-indene |
| 2-methylindane |
| 1-trimethylsiloxy-2-methyl-indan-1-ene |
| trimethyl((2-methyl-1H-inden-3-yl)oxy)silane |
| 2-methyl-1-trimethylsilyloxy-indan-1-ene |
| Silane,trimethyl[(2-methyl-1H-inden-3-yl)oxy] |
| 2-methyl-3-trimethylsilyloxy-1H-indene |