4-methyl-3-nitropyridine-2-carbaldehyde structure
|
Common Name | 4-methyl-3-nitropyridine-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 21203-74-7 | Molecular Weight | 166.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-3-nitropyridine-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6N2O3 |
|---|---|
| Molecular Weight | 166.13400 |
| Exact Mass | 166.03800 |
| PSA | 75.78000 |
| LogP | 1.63390 |
| InChIKey | WSMQBQZASSMEEY-UHFFFAOYSA-N |
| SMILES | Cc1ccnc(C=O)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~20%
4-methyl-3-nitr... CAS#:21203-74-7 |
| Literature: Wang, Yuqiang; Liu, Mao-Chin; Lin, Tai-Shun; Sartorelli, Alan C. Journal of Medicinal Chemistry, 1992 , vol. 35, # 20 p. 3667 - 3671 |
|
~%
4-methyl-3-nitr... CAS#:21203-74-7 |
| Literature: Li, Jun; Chen, Shu-Hui; Li, Xiuyan; Niu, Chuansheng; Doyle, Terrence W. Tetrahedron, 1998 , vol. 54, # 3-4 p. 393 - 400 |
|
~%
4-methyl-3-nitr... CAS#:21203-74-7 |
| Literature: Wang, Yuqiang; Liu, Mao-Chin; Lin, Tai-Shun; Sartorelli, Alan C. Journal of Medicinal Chemistry, 1992 , vol. 35, # 20 p. 3667 - 3671 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-METHYL-3-NITROPICOLINALDEHYDE |
| 4-methyl-3-nitropyridine-2-carboxaldehyde |
| 4-Methyl-3-nitro-pyridin-2-aldehyd |
| 4-METHYL-3-NITRO-2-PYRIDINECARBOXALDEHYDE |
| 4-methyl-3-nitro-pyridine-2-carbaldehyde |