1-Pentanone,1-phenyl-, 2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | 1-Pentanone,1-phenyl-, 2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 2121-88-2 | Molecular Weight | 342.34900 | |
| Density | 1.27g/cm3 | Boiling Point | 486.1ºC at 760 mmHg | |
| Molecular Formula | C17H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 2,4-dinitro-N-[(Z)-1-phenylpentylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 486.1ºC at 760 mmHg |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.34900 |
| Flash Point | 247.8ºC |
| Exact Mass | 342.13300 |
| PSA | 116.03000 |
| LogP | 5.62880 |
| Vapour Pressure | 1.33E-09mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | BKTMDJRUUHNALO-OBGWFSINSA-N |
| SMILES | CCCCC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
|
~%
1-Pentanone,1-p... CAS#:2121-88-2 |
| Literature: Blicke; Sheets Journal of the American Chemical Society, 1949 , vol. 71, p. 4010 |
|
~%
1-Pentanone,1-p... CAS#:2121-88-2 |
| Literature: Evans Journal of the Chemical Society, 1936 , p. 785,788 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Dinitrophenylhydrazon v. 1-Phenyl-1-pentanon |
| n-Valerophenon-2.4-dinitrophenylhydrazon |