3,3'-Dinitrobenzophenone structure
|
Common Name | 3,3'-Dinitrobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 21222-05-9 | Molecular Weight | 272.213 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 458.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H8N2O5 | Melting Point | 153-155°C | |
| MSDS | N/A | Flash Point | 229.1±17.4 °C | |
| Name | bis(3-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.4±30.0 °C at 760 mmHg |
| Melting Point | 153-155°C |
| Molecular Formula | C13H8N2O5 |
| Molecular Weight | 272.213 |
| Flash Point | 229.1±17.4 °C |
| Exact Mass | 272.043335 |
| PSA | 108.71000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | BSDKBWGNIJMCID-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S37/39 |
| HS Code | 2914700090 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| di3-nitrophenyl ketone |
| 3,3'-Dinitro-benzophenon |
| MFCD00039740 |
| 3,3'-Dinitrobenzophenone |
| Bis(3-nitrophenyl)methanone |
| Methanone, bis(3-nitrophenyl)- |