2-nitrobutyl acetate structure
|
Common Name | 2-nitrobutyl acetate | ||
|---|---|---|---|---|
| CAS Number | 2123-71-9 | Molecular Weight | 161.15600 | |
| Density | 1.117g/cm3 | Boiling Point | 197ºC at 760 mmHg | |
| Molecular Formula | C6H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 76.1ºC | |
| Name | 2-nitrobutyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 197ºC at 760 mmHg |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.15600 |
| Flash Point | 76.1ºC |
| Exact Mass | 161.06900 |
| PSA | 72.12000 |
| LogP | 1.12800 |
| Vapour Pressure | 0.387mmHg at 25°C |
| Index of Refraction | 1.434 |
| InChIKey | RLBLQZQADXRYKU-UHFFFAOYSA-N |
| SMILES | CCC(COC(C)=O)[N+](=O)[O-] |
|
~86%
2-nitrobutyl acetate CAS#:2123-71-9 |
| Literature: Pelkey, Erin T.; Gribble, Gordon W. Canadian Journal of Chemistry, 2006 , vol. 84, # 10 p. 1338 - 1342 |
|
~%
2-nitrobutyl acetate CAS#:2123-71-9 |
| Literature: Pauwels Chem. Zentralbl., 1898 , vol. 69, # I p. 193 |
| acetic acid 2-nitro-butyl ester |
| 1-acetoxy-2-nitro-butane |