2-nitrobutyl methacrylate structure
|
Common Name | 2-nitrobutyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 17977-11-6 | Molecular Weight | 187.19300 | |
| Density | 1.087g/cm3 | Boiling Point | 274.9ºC at 760mmHg | |
| Molecular Formula | C8H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117ºC | |
| Name | 2-nitrobutyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 274.9ºC at 760mmHg |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19300 |
| Flash Point | 117ºC |
| Exact Mass | 187.08400 |
| PSA | 72.12000 |
| LogP | 1.68420 |
| Vapour Pressure | 0.00525mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | DOEOZIKIOFMZJE-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(CC)[N+](=O)[O-] |
| HS Code | 2916140000 |
|---|
|
~%
2-nitrobutyl me... CAS#:17977-11-6 |
| Literature: Marans; Zelinski Journal of the American Chemical Society, 1950 , vol. 72, p. 2125 |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| 2-Nitrobutyl methacrylate |
| Methacrylsaeure-2-nitro-1-butylester |
| EINECS 241-898-6 |