(2-methoxyphenyl)-triphenyl-phosphanium structure
|
Common Name | (2-methoxyphenyl)-triphenyl-phosphanium | ||
|---|---|---|---|---|
| CAS Number | 21230-90-0 | Molecular Weight | 496.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22IOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methoxyphenyl)-triphenylphosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H22IOP |
|---|---|
| Molecular Weight | 496.32000 |
| Exact Mass | 496.04500 |
| PSA | 22.82000 |
| LogP | 1.31860 |
| InChIKey | OCPWMBGYIPVSEI-UHFFFAOYSA-M |
| SMILES | COc1ccccc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
|
~%
(2-methoxypheny... CAS#:21230-90-0 |
| Literature: Sumitomo Bakelite Co., Ltd. Patent: EP1369445 A1, 2003 ; Location in patent: Page 17; 30 ; |
|
~26%
(2-methoxypheny... CAS#:21230-90-0 |
| Literature: Migita, Toshihiko; Nagai, Tohru; Kiuchi, Kazuhiko; Kosugi, Masanori Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 9 p. 2869 - 2870 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-methoxyphenyl triphenylphosphonium iodide |