5-[bromo(difluoro)methyl]-3-phenyl-1,2,4-oxadiazole structure
|
Common Name | 5-[bromo(difluoro)methyl]-3-phenyl-1,2,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 212311-55-2 | Molecular Weight | 275.05000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5BrF2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[bromo(difluoro)methyl]-3-phenyl-1,2,4-oxadiazole |
|---|
| Molecular Formula | C9H5BrF2N2O |
|---|---|
| Molecular Weight | 275.05000 |
| Exact Mass | 273.95500 |
| PSA | 38.92000 |
| LogP | 3.18080 |
| InChIKey | XLFVSDJQNYMMMK-UHFFFAOYSA-N |
| SMILES | FC(F)(Br)c1nc(-c2ccccc2)no1 |
|
~33%
5-[bromo(difluo... CAS#:212311-55-2 |
| Literature: Dolbier Jr., William R.; Burkholder, Conrad R.; Medebielle, Maurice Journal of Fluorine Chemistry, 1999 , vol. 95, # 1-2 p. 127 - 130 |
|
~%
5-[bromo(difluo... CAS#:212311-55-2 |
| Literature: Dolbier Jr., William R.; Burkholder, Conrad R.; Medebielle, Maurice Journal of Fluorine Chemistry, 1999 , vol. 95, # 1-2 p. 127 - 130 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |