(±)19(20)-EDP Ethanolamide structure
|
Common Name | (±)19(20)-EDP Ethanolamide | ||
|---|---|---|---|---|
| CAS Number | 2123485-34-5 | Molecular Weight | 387.556 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 568.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H37NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.8±30.1 °C | |
Use of (±)19(20)-EDP Ethanolamide19,20-EDP epoxide is an ω-3 endocannabinoid epoxide and cannabinoid (CB) receptor agonist (EC50s = 108 and 280 nM for CB1 and CB2, respectively). |
| Name | (±)19(20)-EDP Ethanolamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 568.7±50.0 °C at 760 mmHg |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.556 |
| Flash Point | 297.8±30.1 °C |
| Exact Mass | 387.277344 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | HQRHKQCFLLFLJV-MBYQGORISA-N |
| SMILES | CCC1OC1CC=CCC=CCC=CCC=CCC=CCCC(=O)NCCO |
| 4,7,10,13,16-Octadecapentaenamide, 18-(3-ethyloxiranyl)-N-(2-hydroxyethyl)-, (4Z,7Z,10Z,13Z,16Z)- |
| (±)19(20)-EDP Ethanolamide |
| (4Z,7Z,10Z,13Z,16Z)-18-(3-Ethyl-2-oxiranyl)-N-(2-hydroxyethyl)-4,7,10,13,16-octadecapentaenamide |