Isoamyl 4-(dimethylamino)benzoate structure
|
Common Name | Isoamyl 4-(dimethylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 21245-01-2 | Molecular Weight | 235.322 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 337.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H21NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 117.8±14.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Isoamyl 4-(dimethylamino)benzoateIsoamyl 4-(dimethylamino)benzoate can be used for the synthesis of inclusion complex (isoamyl4-(Dimethylamino)benzoate with sulfobutylether-β-cyclodextrin)[1]. |
| Name | 3-methylbutyl 4-(dimethylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Isoamyl 4-(dimethylamino)benzoate can be used for the synthesis of inclusion complex (isoamyl4-(Dimethylamino)benzoate with sulfobutylether-β-cyclodextrin)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.9±25.0 °C at 760 mmHg |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.322 |
| Flash Point | 117.8±14.0 °C |
| Exact Mass | 235.157227 |
| PSA | 29.54000 |
| LogP | 4.55 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | OFSAUHSCHWRZKM-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)c1ccc(N(C)C)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Sunscreens block the induction of unscheduled DNA synthesis and the inhibition of DNA synthesis by UV-B radiation in normal human fibroblasts. A new way of evaluating sunscreen efficacy in vitro.
Derm. Beruf Umwelt. 33(6) , 209-12, (1985) In order to evaluate the photoprotective efficacy of sunscreens against the chronic actinic damage, we tested 3 sunscreens for their ability to reduce the induction of unscheduled DNA synthesis (UDS) ... |
| 4-Dimethylaminobenzoic acid isoamyl ester |
| Spectraban |
| Padimate |
| 3-Methylbutyl-4-dimethylaminobenzoate |
| IsoaMyl 4-(DiMethylaMino)benzoate [contains 2-Methylbutyl 4-(DiMethylaMino)benzoate] |
| Isoamyl Para-N,N-Dimethylaminobenzoate |
| 4-(Dimethylamino)benzoic acid 3-methylbutyl ester |
| Isoamyl 4-(Dimethylamino)benzoate |
| Benzoic acid, 4-(dimethylamino)-, 3-methylbutyl ester |
| Padimate A |
| EINECS 244-288-8 |
| MFCD00059356 |
| 4-(Dimethylamino)benzoic Acid Isoamyl Ester [contains 2-Methylbutyl 4-(Dimethylamino)benzoate] |
| 3-Methylbutyl 4-(dimethylamino)benzoate |