Fmoc-sarcosine Hydrate structure
|
Common Name | Fmoc-sarcosine Hydrate | ||
|---|---|---|---|---|
| CAS Number | 212651-47-3 | Molecular Weight | 329.34700 | |
| Density | N/A | Boiling Point | 512.8°C | |
| Molecular Formula | C18H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-sarcosine Hydrate2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)acetic acid hydrate is a Glycine (HY-Y0966) derivative[1]. |
| Name | Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-, monohydrate (9CI) |
|---|
| Description | 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)acetic acid hydrate is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 512.8°C |
|---|---|
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.34700 |
| Exact Mass | 329.12600 |
| PSA | 76.07000 |
| LogP | 2.88760 |
| InChIKey | CUJSWOOWOONPRH-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21.O |
| Hazard Codes | Xi |
|---|