NG 52 structure
|
Common Name | NG 52 | ||
|---|---|---|---|---|
| CAS Number | 212779-48-1 | Molecular Weight | 346.815 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 587.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C16H19ClN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.2±32.9 °C | |
Use of NG 52NG 52 (Compound 52 ) is a potent, cell-permeable, reversible, selective, and ATP-compatible inhibitor of the cell cycle-regulating kinase, Cdc28p (IC50 = 7 μM), and the related Pho85p kinase (IC50 = 2 μM).IC50 value: 7 uM [1]Target: Cdc28pCompound 52 inhibited growth in a drug-sensitized yeast strainwith a GI 50 of 30 uM. In contrast, the closely related compound 52Me proved to be a significantly weaker inhibitor of yeast growth (GI50=200 uM). |
| Name | 2-[[6-(3-chloroanilino)-9-propan-2-ylpurin-2-yl]amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Description | NG 52 (Compound 52 ) is a potent, cell-permeable, reversible, selective, and ATP-compatible inhibitor of the cell cycle-regulating kinase, Cdc28p (IC50 = 7 μM), and the related Pho85p kinase (IC50 = 2 μM).IC50 value: 7 uM [1]Target: Cdc28pCompound 52 inhibited growth in a drug-sensitized yeast strainwith a GI 50 of 30 uM. In contrast, the closely related compound 52Me proved to be a significantly weaker inhibitor of yeast growth (GI50=200 uM). |
|---|---|
| Related Catalog | |
| Target |
cdc2-cyclin B:0.34 μM (IC50) Pho85p:2 nM (IC50) |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 587.7±60.0 °C at 760 mmHg |
| Molecular Formula | C16H19ClN6O |
| Molecular Weight | 346.815 |
| Flash Point | 309.2±32.9 °C |
| Exact Mass | 346.130890 |
| PSA | 91.12000 |
| LogP | 1.54 |
| Appearance of Characters | white solid |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | XZEFMZCNXDQXOZ-UHFFFAOYSA-N |
| SMILES | CC(C)n1cnc2c(Nc3cccc(Cl)c3)nc(NCCO)nc21 |
| Storage condition | -20℃ |
| Ethanol, 2-[[6-[(3-chlorophenyl)amino]-9-(1-methylethyl)-9H-purin-2-yl]amino]- |
| 2-(2-Hydroxyethylamino)-6-(3-chloroanilino)-9-isopropylpurine NG-52 |
| OLP |
| 2-(2-HYDROXYETHYLAMINO)-6-(3-CHLOROANILINO)-9-ISOPROPYLPURINE |
| compound 52 |
| 2-({6-[(3-Chlorophenyl)amino]-9-isopropyl-9H-purin-2-yl}amino)ethanol |
| 3bpr |
| 2-({6-[(3-chlorophenyl)amino]-9-(propan-2-yl)-9H-purin-2-yl}amino)ethanol |
| NG-52 |
| NG 52 |