Benzene,1-nitro-4-(4-phenoxybutoxy)- structure
|
Common Name | Benzene,1-nitro-4-(4-phenoxybutoxy)- | ||
|---|---|---|---|---|
| CAS Number | 21278-55-7 | Molecular Weight | 287.31000 | |
| Density | 1.181g/cm3 | Boiling Point | 453.1ºC at 760 mmHg | |
| Molecular Formula | C16H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | 1-nitro-4-(4-phenoxybutoxy)benzene |
|---|
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 453.1ºC at 760 mmHg |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31000 |
| Flash Point | 191.2ºC |
| Exact Mass | 287.11600 |
| PSA | 64.28000 |
| LogP | 4.35600 |
| Vapour Pressure | 5.69E-08mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | AVOSADBWMXBHGB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCCCOc2ccccc2)cc1 |
|
~%
Benzene,1-nitro... CAS#:21278-55-7 |
| Literature: Baker; Lourens Journal of medicinal chemistry, 1969 , vol. 12, # 1 p. 95 - 101 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |