Benzene, 1-nitro-4-(phenoxymethyl)- structure
|
Common Name | Benzene, 1-nitro-4-(phenoxymethyl)- | ||
|---|---|---|---|---|
| CAS Number | 3048-12-2 | Molecular Weight | 229.23100 | |
| Density | 1.232g/cm3 | Boiling Point | 381.5ºC at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.9ºC | |
| Name | 1-nitro-4-(phenoxymethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 381.5ºC at 760 mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23100 |
| Flash Point | 172.9ºC |
| Exact Mass | 229.07400 |
| PSA | 55.05000 |
| LogP | 3.69700 |
| Index of Refraction | 1.603 |
| InChIKey | BKSDFYLOSRTHTL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(COc2ccccc2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| O-p-nitrobenzylphenol |
| p-Nitrobenzyl phenyl ether |