Benzenesulfonylfluoride, 4-[2-(2-chloro-4-nitrophenoxy)ethoxy]- structure
|
Common Name | Benzenesulfonylfluoride, 4-[2-(2-chloro-4-nitrophenoxy)ethoxy]- | ||
|---|---|---|---|---|
| CAS Number | 21278-61-5 | Molecular Weight | 375.75700 | |
| Density | 1.486g/cm3 | Boiling Point | 524.6ºC at 760mmHg | |
| Molecular Formula | C14H11ClFNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | 4-[2-(2-chloro-4-nitrophenoxy)ethoxy]benzenesulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 524.6ºC at 760mmHg |
| Molecular Formula | C14H11ClFNO6S |
| Molecular Weight | 375.75700 |
| Flash Point | 271.1ºC |
| Exact Mass | 374.99800 |
| PSA | 106.80000 |
| LogP | 4.96820 |
| Vapour Pressure | 1.42E-10mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | MAAHAOMGWIAKSE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCOc2ccc(S(=O)(=O)F)cc2)c(Cl)c1 |
|
~%
Benzenesulfonyl... CAS#:21278-61-5 |
| Literature: Baker; Lourens Journal of medicinal chemistry, 1969 , vol. 12, # 1 p. 95 - 101 |
|
~%
Benzenesulfonyl... CAS#:21278-61-5 |
| Literature: Baker; Lourens Journal of medicinal chemistry, 1969 , vol. 12, # 1 p. 95 - 101 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(p-Fluorsulfonyl-phenoxy)-2-(2-chlor-4-nitro-phenoxy)-aethan |
| Benzenesulfonylfluoride,4-[2-(2-chloro-4-nitrophenoxy)ethoxy] |