DBCO-PEG4-VC-PAB-MMAE structure
|
Common Name | DBCO-PEG4-VC-PAB-MMAE | ||
|---|---|---|---|---|
| CAS Number | 2129164-91-4 | Molecular Weight | 1658.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C88H128N12O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DBCO-PEG4-VC-PAB-MMAEDBCO-PEG4-VC-PAB-MMAE consists a ADC linker (DBCO-PEG4-VC-PAB) and a tubulin polymerization inhibitor MMAE (HY-15162). DBCO-PEG4-VC-PAB-MMAE can be used in the synthesis of antibody-drug conjugates (ADCs). MMAE is a synthetic derivative of dolastatin 10 and functions as a potent mitotic inhibitor by inhibiting tubulin polymerization[1]. |
| Name | DBCO-PEG4-VC-PAB-MMAE |
|---|
| Description | DBCO-PEG4-VC-PAB-MMAE consists a ADC linker (DBCO-PEG4-VC-PAB) and a tubulin polymerization inhibitor MMAE (HY-15162). DBCO-PEG4-VC-PAB-MMAE can be used in the synthesis of antibody-drug conjugates (ADCs). MMAE is a synthetic derivative of dolastatin 10 and functions as a potent mitotic inhibitor by inhibiting tubulin polymerization[1]. |
|---|---|
| Related Catalog | |
| Target |
Duocarmycins |
| References |
| Molecular Formula | C88H128N12O19 |
|---|---|
| Molecular Weight | 1658.03 |
| InChIKey | LJJUBMUNOGZMDD-UDEUCFDSSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(C)C(O)c1ccccc1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N2Cc3ccccc3C#Cc3ccccc32)C(C)C)cc1)C(C)C |
| Hazard Codes | Xi |
|---|