(R)-2-AMINO-BUT-3-EN-1-OLHYDROCHLORIDE structure
|
Common Name | (R)-2-AMINO-BUT-3-EN-1-OLHYDROCHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 21307-97-1 | Molecular Weight | 208.21100 | |
| Density | 1.29 | Boiling Point | 331.4ºC at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-2-Benzylsuccinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29 |
|---|---|
| Boiling Point | 331.4ºC at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Exact Mass | 208.07400 |
| PSA | 74.60000 |
| LogP | 1.40460 |
| Vapour Pressure | 6.23E-05mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | GTOFKXZQQDSVFH-SECBINFHSA-N |
| SMILES | O=C(O)CC(Cc1ccccc1)C(=O)O |
| HS Code | 2917399090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Experimentally measured binding affinity data (Ki) for protein-ligand complexes deriv...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-Ki for protein-ligand complexes
|
| Nalpha-Cbz-D-asparagine |
| Z-D-asparagine |
| N-Cbz-D-Asparagine |
| Nalpha-Carbobenzoxy-D-asparagine |
| N2-benzyloxycarbonyl-D-asparagine |
| Z-D-Asn-OH |
| Cbz-D-Asn-OH |
| N2-Benzyloxycarbonyl-D-asparagin |