2-(Phenylmethylene)butanedioic acid structure
|
Common Name | 2-(Phenylmethylene)butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 5653-88-3 | Molecular Weight | 206.19500 | |
| Density | 1.352 | Boiling Point | 420.2ºC at 760 mmHg | |
| Molecular Formula | C11H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.1ºC | |
| Name | 2-benzylidenesuccinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352 |
|---|---|
| Boiling Point | 420.2ºC at 760 mmHg |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19500 |
| Flash Point | 222.1ºC |
| Exact Mass | 206.05800 |
| PSA | 74.60000 |
| LogP | 1.62930 |
| Index of Refraction | 1.631 |
| InChIKey | KYILORDWJFEQBS-RMKNXTFCSA-N |
| SMILES | O=C(O)CC(=Cc1ccccc1)C(=O)O |
| HS Code | 2917399090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Phenyl-2-propene-1,2-dicarboxylic acid |
| 2-(phenylMethylidene)butanedioic acid |
| (E)-phenylitaconic acid |
| trans-phenylitaconic acid |
| benzylidene succinic acid |
| 2-(Phenylmethylene)butanedioic acid |
| 2-Carboxymethyl-3-phenylpropenoic acid |
| (2E)-2-benzylidenebutanedioic acid |
| (E)-benzylidenesuccinic acid |