4-[2-(4-aminophenyl)ethyl]benzenesulfonyl fluoride structure
|
Common Name | 4-[2-(4-aminophenyl)ethyl]benzenesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 21316-08-5 | Molecular Weight | 279.33000 | |
| Density | 1.293g/cm3 | Boiling Point | 397.5ºC at 760 mmHg | |
| Molecular Formula | C14H14FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 4-[2-(4-aminophenyl)ethyl]benzenesulfonyl fluoride |
|---|
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 397.5ºC at 760 mmHg |
| Molecular Formula | C14H14FNO2S |
| Molecular Weight | 279.33000 |
| Flash Point | 194.2ºC |
| Exact Mass | 279.07300 |
| PSA | 68.54000 |
| LogP | 4.37420 |
| Vapour Pressure | 1.58E-06mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | UACOXIFJYLZLIF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(CCc2ccc(S(=O)(=O)F)cc2)cc1 |
|
~%
4-[2-(4-aminoph... CAS#:21316-08-5 |
| Literature: Baker; Lourens Journal of medicinal chemistry, 1969 , vol. 12, # 1 p. 95 - 101 |
|
~%
4-[2-(4-aminoph... CAS#:21316-08-5 |
| Literature: Baker; Lourens Journal of medicinal chemistry, 1969 , vol. 12, # 1 p. 95 - 101 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |