Benzeneacetic acid,4-methyl-a-[(4-nitrophenyl)methylene]- structure
|
Common Name | Benzeneacetic acid,4-methyl-a-[(4-nitrophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 21316-18-7 | Molecular Weight | 283.27900 | |
| Density | 1.316g/cm3 | Boiling Point | 403.6ºC at 760 mmHg | |
| Molecular Formula | C16H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | (Z)-2-(4-methylphenyl)-3-(4-nitrophenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 403.6ºC at 760 mmHg |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.27900 |
| Flash Point | 164.8ºC |
| Exact Mass | 283.08400 |
| PSA | 83.12000 |
| LogP | 4.05160 |
| Vapour Pressure | 3.07E-07mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | GRTMODVOMTUGFW-GDNBJRDFSA-N |
| SMILES | Cc1ccc(C(=Cc2ccc([N+](=O)[O-])cc2)C(=O)O)cc1 |
|
~%
Benzeneacetic a... CAS#:21316-18-7 |
| Literature: Baker,B.R.; Lourens,G.J. Journal of Medicinal Chemistry, 1968 , vol. 11, # 4 p. 672 - 676 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| trans-2-<4-Methyl-phenyl>-3-<4-nitrophenyl>-acrylsaeure |